Consulter notre stock
530 millions de pièces
Vous trouverez une pagination vous permettant d’accéder à un extrait du listing des pièces que nous avons en stock. Ce listing est remis à jour tous les mois; dernière mise à jour le 3 juin 2026.

Votre pièce n’est pas dans notre stock !
Notre listing complet est intégré dans la banque de données mondiale que nous vous invitons à consulter.
Listing des pièces
| Numéro de pièce | Quantité | Fabricant | Date code | Description | |
|---|---|---|---|---|---|
| F524.650DA8B | 1 | BAUMER | - | - | Demande d’informations |
| F682210 | 2 | FCI | - | CLIP DE 9.5mm SERIE DCS | Demande d’informations |
| F7XC535558098--1 | 5 | MECACHROME TOULOUSE | - | Structure métallique-620109201 | Demande d’informations |
| C4BQ2105KBSC000 | 50 | FARATRONIC | - | Electronics Passive Components | Demande d’informations |
| F921A105MPA | 4 | - | C.TA.1U.10V.P.20% F921A105MPA | Demande d’informations | |
| F92520370000 | 1 | - | STRUCTURE MÉTALLIQUE-F92520370000 | Demande d’informations | |
| F931A107MBA | 1801 | Avx | 2020 | C TAN >10V 100µ <20% 3528 | Demande d’informations |
| F9-4-220N | 231 | COLUMBIA | 2017 | DISSIPATEUR TO220 20°C/W A CLI | Demande d’informations |
| FA-12832.0000MF20X-K3 | 437 | EPSON TOYOCOM | 2020 | QUARTZ 32MHz 2x1.6x0.5 CMS FON | Demande d’informations |
| FA-238.16.0000MA30X-AGO | 40 | EPSON | - | QTZ FA-238 16.0000MA30X-AGO | Demande d’informations |
| FA-23824.0000MB-C0 | 3 | - | Q. 24MHZ 50PPM 18PF FA-238 24.0000MB-C0 | Demande d’informations | |
| FA-238V | 45 | - | QUARTZ FA-238V 12MHZ 10PF 50PPM | Demande d’informations | |
| FAN4174IS5X | 1965 | FAIRCHILD | 1652 | FAN4174IS5X | Demande d’informations |
| FAN4931IP5X | 157 | FAIRCHILD | - | FAN4931IP5X SC70-5 | Demande d’informations |
| FAR-F6KA-1G7475-D4CY-Z | 4 | - | FAR-F6KA-1G7475-D4CY-Z (TAIYO YUDEN) | Demande d’informations | |
| FAR-F6KA-1G8425-D4CK | 201 | - | FAR-F6KA-1G8425-D4CK 1.4X1X0.5 | Demande d’informations | |
| FBMJ2125HS420-T | 6 | TAIY | - | FERR. 0805 39R FBMJ2125HS420-T | Demande d’informations |
| FBS-3-8 | 98 | PHOENIX | - | PEIGNE 3V ROUGE PAS 8.2 | Demande d’informations |
| FC0V474ZFTBR24 | 4 | - | C.AL.470000U.3V5.FC0V474ZFTBR24 | Demande d’informations | |
| FC-135.32.7680KA-AC3 | 9 | - | FC-135 32.7680KA-AC3 20PPM 9P | Demande d’informations | |
| FCI92250-088LF | 210 | AMPHENO LFCI | - | CNT10 RJ45 | Demande d’informations |
| FCN700A1 | 240 | - | CLIP DE POLARISATION FCN700A1 (BLANC) | Demande d’informations | |
| FCS0H104ZFTBR24 | 350 | KEMET | - | COD Super condensateur 5.5V 10 | Demande d’informations |
| FCXO-06 | 52 | - | QUARTZ RIVE/FCXO-06-37.4M | Demande d’informations | |
| FDC608PZ | 187 | ON SEMI | - | FDC608PZ SOT23 | Demande d’informations |
| FDC6330L | 2192 | FAIRCHILD | - | TRANS FDC6330L / 20V 2.3A CANA | Demande d’informations |
| FDC6330L | 128 | ON SEMI | - | FDC6330L SOT23-6 | Demande d’informations |
| FDC6333C | 5 | ON SEMI | - | FDC6333C SOT-23-6 | Demande d’informations |
| FDC637BNZ | 1966 | ON SEMI | - | FDC637BNZ SOT23-6 | Demande d’informations |
| FDD1600N10ALZ | 9975 | - | - | Demande d’informations | |
| FDD18N20LZ | 500 | - | - | Demande d’informations | |
| FDD5353 | 1969 | FAIRCHILD | 1701 | TRANSIS TO252-3 FDD5353 | Demande d’informations |
| FDG6306P | 12 | - | MOSFET 2P-CH 20V 0.6A FDG6306P SOT363 | Demande d’informations | |
| FDG6317NZ | 175 | ON SEMI | - | TRANS. MOSFET N FDG6317NZ SOT-363 | Demande d’informations |
| FDG6331L | 46 | ON SEMI | - | FDG6331L SOT-363 | Demande d’informations |
| FDMA910PZ | 10 | NXP | - | PMOSFET FDMA910PZ MICROFET-6 | Demande d’informations |
| FDMQ8205 | 13 | ON SEMI | - | FDMQ8205 WDFN12 | Demande d’informations |
| FDMS86520 | 228 | ONSEMI | - | MOSFET 60V N-Channel PowerTren | Demande d’informations |
| BSC093N15NS5 | 4 | INFINEON TECHNOLOGIES | - | Electronics Active Components | Demande d’informations |
| FDN304P | 181 | ON SEMI | - | FDN304P SOT23 | Demande d’informations |
| FDN340P | 65 | ON SEMI | - | FDN340P SOT-23 | Demande d’informations |
| FDN352AP | 1937 | ON SEMI | - | FDN352AP SOT23 | Demande d’informations |
| FDN357N | 1496 | FAIRCHILD | - | TRS SSOT-3 N-CH 30V | Demande d’informations |
| FDN358P | 2190 | FAIRCHILD | - | MOSFET SSOT-3 P-CH -30V | Demande d’informations |
| FDN360P | 2324 | ON SEMICONDUCTOR | - | Electronics Active Components | Demande d’informations |
| DMG3404L-13 | 74 | DIODES | - | Electronics Active Components | Demande d’informations |
| FDN5630 | 3000 | 1724 | - | Demande d’informations | |
| FDS6690A | 1860 | - | - | Demande d’informations | |
| FDV302P | 378 | ON SEMI | - | FDV302P | Demande d’informations |
| FDV303N | 80 | ON SEMI | - | FDV303N | Demande d’informations |
| FDY3000NZ | 15 | ON SEMI | - | FDY3000NZ SC89-6 | Demande d’informations |
| FENG-32-100-KF | 1 | FESTO | - | - | Demande d’informations |
| FENG-40-250-KF | 1 | FESTO | - | - | Demande d’informations |
| FENG-50-200-KF | 1 | FESTO | - | - | Demande d’informations |
| FENG-50-320-KF | 1 | FESTO | - | - | Demande d’informations |
| FFC2A32-12-T-R | 90 | GCT | 20+ | CONNECT CMS FFC/FPC ZIF 12POS DROIT | Demande d’informations |
| FFFM-C54L020-AEK/Z023C919 | 1 | MOLEX | 23+ | Twin 1x10 WSS. 88 channels. 25 | Demande d’informations |
| FF-MPFE18A1-CS | 1 | HONEYWELL | - | - | Demande d’informations |
| FFMSH302505524 | 3113 | FITTINGS FOR INDUSTRY | - | Standard Hardware | Demande d’informations |
| FF-SYA14096C2E | 1 | HONEYWELL | - | - | Demande d’informations |
| FGFB600914110E2 | 1 | - | Structure métallique-ARMOIRE GAUCHE SUPP | Demande d’informations | |
| FH12-16S-1SH | 1214 | HIROSE | - | CONNECTEUR 16PTS FFC FH12-16S-1SH.HIROSE | Demande d’informations |
| FH12-36S-0.5SH | 15 | - | CONN. HIROSE FH12-36S-0.5SH | Demande d’informations | |
| FH12-36S-0.5SV | 8 | - | CONN. HIROSE FH12-36S-0.5SV | Demande d’informations | |
| FH19C-4S-0.5SH | 47 | HIROSE | - | CONN. 4PTS FH19C-4S-0.5SH.HIROSE | Demande d’informations |
| FH33-10S-0.5SH(10) | 2 | - | CONN. FFC HIROSE FH33-10S-0.5SH(10) | Demande d’informations | |
| FH34S-4S-0.5SH(50) | 14 | HIROSE | - | CONN. FFC 4PTS FH34S-4S-0.5SH(50).HIROSE | Demande d’informations |
| FH34SRJ-14S-0.5SH(99) | 2 | - | CONN. FH34SRJ-14S-0.5SH(99) | Demande d’informations | |
| FH58M-7S-0.25SHW(99) | 100 | - | CONN. HIROSE FH58M-7S-0.25SHW(99) | Demande d’informations | |
| FIB7028018 | 22 | FIBOX | - | CAPUCHON DECORATIF MB28018 | Demande d’informations |
| FID223202304320 | 33 | - | Organe de coupure - Relais - Inter à bas | Demande d’informations | |
| DS90LV011AQMF/NOPB | 99 | TEXAS INSTRUMENTS | - | Electronics Active Components | Demande d’informations |
| DS90LT012AHMF/NOPB | 156 | TEXAS INSTRUMENTS | - | Electronics Active Components | Demande d’informations |
| FIN405290120000 | 9 | FINDER | - | RELAIS 12V 8A | Demande d’informations |
| FKC2.5HC/4-ST-5.08 | 28 | PHOENIX | 20 | BORNIER A RESSORT P:5.08 0.2 m | Demande d’informations |
| FKFSXEIHM0.032768-T3 | 1800 | FOX | - | QUARTZ ESR = 65 kOhm - LoadCap | Demande d’informations |
| FL0915P7 | 17614 | - | Connecteur rectangulaire - Acier - Fiche | Demande d’informations | |
| FLKM40 | 5 | PHOENIX CONTACT | - | - | Demande d’informations |
| FLSWITCH1005N-2SFX | 1 | PHOENIX CONTACT | - | - | Demande d’informations |
| FM12A72V18AT | 10 | - | FUSIBLE MIL-PRF-23419/012 0.125A | Demande d’informations | |
| FM24W256-G | 1644 | - | - | Demande d’informations | |
| FM25V02A-GTR | 10 | Cypress Semiconducto | 2043 | CI.CMS FRAM SO8 40MHz 256kBITS | Demande d’informations |
| FM3130-G | 140 | - | - | Demande d’informations | |
| FMC1.5/ 2-ST-3.81 | 201 | PHOENIX | 20 | BORNIER A RESSORT P:3.81 0.2 m | Demande d’informations |
| FMC1.5/ 6-ST-3.81 | 8 | PHOENIX | - | BORNIER A RESSORT P:3.81 0.2 m | Demande d’informations |
| FMC1.5/ 8-ST-3.81 | 28 | PHOENIX | 20 | BORNIER A RESSORT P:3.81 0.2 m | Demande d’informations |
| FMC1.5/4-ST-3.81 | 212 | PHOENIX | 20 | BORNIER A RESSORT P:3.81 0.2 m | Demande d’informations |
| FMMT458 | 3 | - | TRANS. NPN FMMT458 SOT23-3 | Demande d’informations | |
| FMMT459TA | 1000 | DIODES | - | TRANS STR1550 500V 150mA SOT23 | Demande d’informations |
| FMMT593TA | 33195 | ZETEX | - | TRANS PNP FMMT593 | Demande d’informations |
| FMMT624TA | 4 | DISCOMP | - | FMMT624TA SOT-23 | Demande d’informations |
| FMMT720 | 2000 | - | TRANS. PNP FMMT720 SOT23 | Demande d’informations | |
| FMP100JR-52-10R | 150 | YAGEO | - | RESISTANCE 10R 1W 5% FMP100JR-52-10R.YAG | Demande d’informations |
| FM-T3528WDS-460T-R70 | 27376 | - | FM-T3528WDS-460T-R70 HUE:4C | Demande d’informations | |
| FN15N0R5C500PNG | 12240 | PDC | - | COND 0.5pF ±0.25pF 0402 COG 50 | Demande d’informations |
| FN15N100J500PNG | 33626 | PDC | - | COND 10pF 50V NPO 5% 0402 | Demande d’informations |
| FN15N150J500PNG | 82931 | PDC | - | C 0402 15pF COG 50V ±5% | Demande d’informations |
| FN15N151K500PNG | 9752 | PDC | - | COND 150pF 10% NPO 0402 | Demande d’informations |
| FN15N180J500PNG | 130931 | PDC | - | COND 18pF ±5% 0402 50V COG | Demande d’informations |
| FN15N1R8B500PNG | 64321 | PDC | - | C 0402 1.8pF COG 50V ±0.1pF | Demande d’informations |
| FN15N2R2B500PNG | 84753 | PDC | - | C 0402 2.2pF COG 50V ±0.1pF | Demande d’informations |
| FN15N330J500PNG | 30926 | PDC | - | COND 33pF 50V 5% 0402 COG YAGE | Demande d’informations |
| FN15N390J500PNG | 66406 | PDC | - | COND 39 pF 5% 50V NPO 0402 | Demande d’informations |
| FN15X102K500PNG | 278715 | PDC | - | COND 1nF 10% 0402 50V X7R | Demande d’informations |
| FN15X472K500PNG | 9618 | PDC | - | C 0402 4.7nF 10% X7R 50V 0402 | Demande d’informations |
| FN18X102K500PSG | 80377 | PDC | - | COND 1nF 10% 63V 0603 X7R | Demande d’informations |
| FN18X104K500PBG | 228607 | PDC | - | COND 100nF 10% 0603 50V X7R | Demande d’informations |
| FN18X153J500PSG | 39204 | YAGEO | - | C 0603 15nF X7R 50V ±5% | Demande d’informations |
| FN2030B-3-06 | 10 | SCHAFNER | - | FILTRE SCHAFFNER 3A FN2030B-3-06 SCHAFNE | Demande d’informations |
| FN21N151J500PAG | 21584 | PDC | - | C 0805 150pF COG 50V ±5% | Demande d’informations |
| FN21N220J500PAG | 107007 | PDC | - | C 0805 22pF COG 50V ±5% | Demande d’informations |
| FN21X104K500PXG | 200107 | PDC | - | COND 100nF 10% 50V 0805 X7R | Demande d’informations |
| FN21X104M500PXG | 108106 | PDC | - | C 0805 100nF X7R 50V ±20% | Demande d’informations |
| FN332-3-05 | 19 | Schaffner | 2019 | FILTRE EMI A COSSE 250V 3A | Demande d’informations |
| FND367 | 200 | - | Affichage Sept Segment 0.362-lnch Qualit | Demande d’informations | |
| FOD2711ASD | 162 | - | OPTO FOD2711ASD 8SMD | Demande d’informations | |
| FODM8801C | 92 | ON SEMI | - | OPTO CMS SO4 FODM8801C | Demande d’informations |
| FP3-4R7 | 5 | COOPER | - | SELF FP3-4R7.COOPER BUSMAN | Demande d’informations |
| FQD13N06T | 41 | - | TRANS. MOSFET N FQD13N06T DPAK | Demande d’informations | |
| FQD16N25CTM | 1132 | - | - | Demande d’informations | |
| FQD3P50TM | 249 | ON SEMICONDUCTOR | - | Electronics Active Components | Demande d’informations |
| FQD8P10TM | 2506 | FAIRCHILD | - | TRANS POWER MOS FQD8P10 DPACK | Demande d’informations |
| FR05-S1-R-0-105 | 18 | - | ANTENNE FR05-S1-R-0-105 | Demande d’informations | |
| FR-D720S-042SC-EC | 1 | MITSUBISHI ELECTRIC | - | - | Demande d’informations |
| FRK78/7-800 | 1 | LEUZE ELECTRONIC | - | - | Demande d’informations |
| FS126822 | 180 | BISCO | - | ECROUS-ALUMINIUM | Demande d’informations |
| FS18OR18-300/500V-3G1.5 | 640 | TRIVENETA CAVI | - | Wires. Cables and Conductors | Demande d’informations |
| FS6008-16-07 | 1 | SCHAFFNER | - | - | Demande d’informations |
| FSA2567UMX | 2 | ON SEMI | - | FSA2567UMX UMLP16 | Demande d’informations |
| FSM16JH | 69 | Alcoswitch | - | TACT SWITCH 6MM FSM16JH.Alcoswitch | Demande d’informations |
| FSM25E | 32 | MARATHON SPECIAL PRODUCTS | - | Protecting and Control Elements | Demande d’informations |
| FSM2JAH | 1 | TE | - | Tactile Switches 6MM HIGH TEMP TACT SWIT | Demande d’informations |
| FSM4JSMAATR | 111 | TYCO | - | BP FSM4JSMAATR.TYCO 6x6x5 | Demande d’informations |
| FSM4JSMATR | 10 | - | BP FSM4JSMATR | Demande d’informations | |
| FSMRA2JH | 86 | - | BOUTON POUSSOIR FSMRA2JH | Demande d’informations | |
| FSRLF327 | 3000 | CITIZEN | - | QUARTZ SMC CM200S 32.768KHz | Demande d’informations |
| FSXLF327 | 100 | FOX | - | QUARTZ FSXLF327 SMD | Demande d’informations |
| FT2232HPQ-TRAY | 50 | FTDI | 23+ | - | Demande d’informations |
| FT3001UMX | 4 | - | FT3001UMX UMLP10 | Demande d’informations | |
| FTR-103-01-S-S | 47 | - | CONN. 3PTS PAS2.54 H=10MM FTR-103-01-S-S | Demande d’informations | |
| FTR-104-01-S-S | 33 | - | CONN. 4PTS PAS2.54 H=10MM FTR-104-01-S-S | Demande d’informations | |
| FTR-108-01-S-D | 10 | SAMTEC | - | CONN. 2x8 P1.27MM FTR-108-01-S-D.SAMTEC | Demande d’informations |
| FTS-108-01-L-DV | 3 | SAMTEC | - | CONN. SAMTEC FTS-108-01-L-DV | Demande d’informations |
| FTSH-105-01-F-DV-P-TR | 482 | SAMTEC | - | Electrical Connectors | Demande d’informations |
| FTSH-105-01-L-DV-K-A-P-TR | 287 | SAMTEC | - | CNT 10POS DUAL .05 | Demande d’informations |
| FTZ5.6ET148 | 140 | ROHM | - | FTZ5.6ET148 | Demande d’informations |
| FVWS1.25-6(LF) | 400 | JST | - | COSSE A OEILLET ROUGE M6 22-16 AWG FVWS1 | Demande d’informations |
| FW-10-02-F-D-225-065 | 4 | SAMTEC | - | CONNECT A PIQUER MD 1.27MM H=10.6MM FW-1 | Demande d’informations |
| FW-10-04-F-D-225-065 | 18 | SAMTEC | - | CONNECTEUR A PIQUER FW-10-04-F-D-225-065 | Demande d’informations |
| FW-8-02-F-D-300-200 | 6 | SAMTEC | - | CONNECT A PIQUER MD 1.27MM H=12.7MM FW-8 | Demande d’informations |
| FW-8-04-F-D-300-200 | 18 | SAMTEC | - | CONNECTEUR A PIQUER FW-8-04-F-D-300-200 | Demande d’informations |
| FX003QC | 26 | - | DECODEUR | Demande d’informations | |
| FX2C-20S-1.27DSA(71) | 77 | - | CONN. HIROSE FEMELLE DROIT 1.27mm 20p FX | Demande d’informations | |
| FX3-XTIO84002 | 1 | SICK | - | - | Demande d’informations |
| FX503C | 26 | - | CODEUR | Demande d’informations | |
| FZT849TA | 59 | DIODES | - | Electronics Active Components | Demande d’informations |
| FZT949TA | 59 | DIODES | - | Electronics Active Components | Demande d’informations |
| G0313 | 10 | GAINTA | 2020 | CONTACT A CLIPSER PILE AA TRIP | Demande d’informations |
| G2RL-1-E-DC12 | 5 | OMRO | - | RELAIS G2RL-1-E-DC12 | Demande d’informations |
| G2RL-224VDC | 456 | OMRO | - | RELAIS G2RL-2 24VDC OMRON | Demande d’informations |
| G4113010 | 88 | SCHLEMER | - | ECROU PG13 PA6.6F GRIS | Demande d’informations |
| G43270017 | 10 | - | QUARTZ 32.768K ECER/G43270017 | Demande d’informations | |
| G51F1C-P03QP00A000 | 6 | Odu-Usa | 2021 | EMB CYLINDRIQUE 3pts COUDE A P | Demande d’informations |
| G52MC7-P04QP00A041 | 3 | Odu-Usa | 2020 | EMB CYLINDRIQUE 4pts DROIT A P | Demande d’informations |
| G52MF7-P04QP000061 | 8 | Odu-Usa | 2020 | EMB CYLINDRIQUE 4pts DROIT A P | Demande d’informations |
| G5CA-1A-5VDC | 49 | OMRO | - | RELAIS G5CA-1A-5VDC | Demande d’informations |
| G5V-1-12VDC | 30 | OMRON | 2020 | RELAIS MONO 12V 1RT 30W 1A | Demande d’informations |
| G5V-25DC | 71 | OMRO | - | RELAIS OMRON G5V-2 5DC | Demande d’informations |
| G5V2-H1-12 | 89 | OMRO | - | RELAIS G5V2-H1-12 VDC | Demande d’informations |
| G6C-1114P | 1077 | - | - | Demande d’informations | |
| G6D-1A-ASI | 130 | OMRO | - | RELAIS OMRON G6D-1A-ASI 12VDC | Demande d’informations |
| G6DN-1A-LDC12 | 80 | OMRON | - | RELAIS 12V 1RT 5A 30Vdc G6DN-1A-LDC12 | Demande d’informations |
| G6K-2F-TR24DC | 148 | OMRON | - | Electronics Active Components | Demande d’informations |
| GAL16V8D-15LPN | 1 | - | GAL16V8D-15LPN | Demande d’informations | |
| GB2CB12 | 1 | SCHNEIDER ELECTRIC | - | - | Demande d’informations |
| GBLC12C | 60 | - | TVS GBLC12C BIDIR SOD-323 | Demande d’informations | |
| GBPC2510W | 3984 | GENESIC SEMICONDUCTOR | - | BRIDGE DIODES VS-GBPC2506W LF | Demande d’informations |
| GBPC5006-G | 2103 | COMCHIP | 1120 | PONTE RADD. PTH 100V 50A TAIWAN S. GBPC5 | Demande d’informations |
| GC0006C14A2HP | 22 | - | GC0006-C-14-A-2HP CAPOT MICROCOMP TAILLE | Demande d’informations | |
| GC0008H18A2HP | 14 | - | GC0008-H-18-A-2HP CAPOT MICROCOMP TAILLE | Demande d’informations | |
| GC0009B500707A2HP | 4 | GAUTHIER CONNECTIQUE | - | GC0009-B-50-07-07-A-2HP CAPOT 2 CHEMINEE | Demande d’informations |
| GC0009E500707A2HP | 6 | - | GC0009-E-50-07-07-A-2HP CAPOT 2 CHEMINEE | Demande d’informations | |
| GC0009PE400606A2HP | 7 | - | GC0009P-E-40-06-06-A-2HP CAPOT SUBD TAIL | Demande d’informations | |
| GC0037452730A2HP | 4 | - | GC0037-45-27-30-A-2HP CAPOT 028-8021-27 | Demande d’informations | |
| GC0055P2C50A2HP | 15 | - | GC0055P2-C-50-A-2HP CAPOT SUB-D DOUBLE H | Demande d’informations | |
| GC0079P2C50A2HP | 6 | - | GC0079P2-C-50-A-2HP CAPOT SUB-D DOUBLE H | Demande d’informations | |
| GCAS0300613524A2HP | 8 | - | GCAS03.00.61.35.24.A.2HP STRAIGHT BACKSH | Demande d’informations | |
| GCF03001914A2HP | 8 | - | GCF03-00-19-14-A-2HP RACCORD A REPRISE D | Demande d’informations | |
| GCF03002114A2HP | 8 | - | GCF03-00-21-14-A-2HP RACCORD A REPRISE D | Demande d’informations | |
| GCF03451914A2HP | 16 | - | GCF03-45-19-14-A-2HP RACCORD 45° 38999 S | Demande d’informations | |
| GCF03452114A2HP | 16 | - | GCF03-45-21-14-A-2HP RACCORD 45° 38999 S | Demande d’informations | |
| GCJ188R71H103KA01D | 2197 | KYOCER-AVX | - | COD 10nF 10% 50V X7R SOFTTERM | Demande d’informations |
| GCJ21BR71A106KE01L | 3000 | MURATA | - | CAP 10uF 10% 10V X7R 0805 SOFT | Demande d’informations |
| GCJ21BR71A106KE01L | 1500 | MURATA | - | CAP 10uF 10% 10V X7R 0805 SOFT | Demande d’informations |
| GCJ31CR71H225KA12L | 1664 | MURATA | - | COND 2.2µF 10% 50V 1206 X7R | Demande d’informations |
| GCM1555C1H150JA16D | 9465 | - | COND 15PF 0402 GCM15558C1H150JA16D | Demande d’informations | |
| GCM1555C1H151JA16D | 10000 | MURATA | - | CAP 150pF 5% 50V C0G 0402 | Demande d’informations |
| GCM1555C1H221JA16D | 2465 | KEMET | - | COD 220pF 5% 50V COG 0402 | Demande d’informations |
| GCM1555C1H240JA16D | 6 | - | C.23P.0402.50V.NPO.5% GCM1555C1H240JA16D | Demande d’informations | |
| GCM1555C1H470JA16J | 19382 | MURATA | - | CONDO 47pF 5% 50V 0402 COG | Demande d’informations |